What is the molecular formula of trans-2,5-Difluorocinnamic acid?
The molecular formula of trans-2,5-Difluorocinnamic acid is C9H6F2O2.
What is the molecular weight of trans-2,5-Difluorocinnamic acid?
The molecular weight of trans-2,5-Difluorocinnamic acid is 184.14 g/mol.
What is the IUPAC name of trans-2,5-Difluorocinnamic acid?
The IUPAC name of trans-2,5-Difluorocinnamic acid is (E)-3-(2,5-difluorophenyl)prop-2-enoic acid.
What are some synonyms for trans-2,5-Difluorocinnamic acid?
Some synonyms for trans-2,5-Difluorocinnamic acid include 2,5-Difluorocinnamic acid, (E)-3-(2,5-Difluorophenyl)acrylic acid, and 3-(2,5-Difluorophenyl)acrylic acid.
What is the Canonical SMILES representation of trans-2,5-Difluorocinnamic acid?
The Canonical SMILES representation of trans-2,5-Difluorocinnamic acid is C1=CC(=C(C=C1F)C=CC(=O)O)F.
What is the InChIKey for trans-2,5-Difluorocinnamic acid?
The InChIKey for trans-2,5-Difluorocinnamic acid is XAWHCSKPALFWBI-DAFODLJHSA-N.
How many hydrogen bond donor counts does trans-2,5-Difluorocinnamic acid have?
Trans-2,5-Difluorocinnamic acid has 1 hydrogen bond donor count.
What is the XLogP3-AA value for trans-2,5-Difluorocinnamic acid?
The XLogP3-AA value for trans-2,5-Difluorocinnamic acid is 2.1.
Is trans-2,5-Difluorocinnamic acid a canonicalized compound?
Yes, trans-2,5-Difluorocinnamic acid is a canonicalized compound.
What is the European Community (EC) Number for trans-2,5-Difluorocinnamic acid?
The European Community (EC) Number for trans-2,5-Difluorocinnamic acid is 628-615-5.
※ Please kindly note that our products are for research use only.