What is the PubChem CID of the compound described in the reference?
The PubChem CID is 56835755.
What is the molecular formula of the compound?
The molecular formula is C15H11N4O2.
What is the molecular weight of the compound?
The molecular weight is 279.27 g/mol.
When was the compound created in PubChem?
The compound was created on March 15, 2012.
When was the compound last modified in PubChem?
The compound was last modified on December 30, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-(hydroxymethyl)-8-(1H-pyrrol-2-yl)-[1,2,4]triazolo[4,3-a]quinolin-10-ium-1-one.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C15H10N4O2/c20-8-10-7-14-17-18-15(21)19(14)13-6-9(3-4-11(10)13)12-2-1-5-16-12/h1-7,20H,8H2/p+1.
What is the InChIKey of the compound?
The InChIKey of the compound is XDKKMYPHFSXIHI-UHFFFAOYSA-O.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CNC(=C1)C2=CC3=C(C=C2)C(=CC4=[N+]3C(=O)N=N4)CO.
Is the compound canonicalized?
Yes, the compound is canonicalized.