Tetrapropyl ammonium hydrogensulfate

• CAS: 56211-70-2
• Catalog Number: ACM56211702
• Category: Ammonium Ionic Liquids
• Molecular Weight: 283.43
• Molecular Formula: C12H28NO4S
• Abbreviation: N3,3,3,3HSO4
• Chemical Formula: N3,3,3,3HSO4

Custom Q&A

What is the molecular formula of Tetrapropyl ammonium hydrogensulfate?

The molecular formula of Tetrapropyl ammonium hydrogensulfate is C12H29NO4S.

What is the molecular weight of Tetrapropyl ammonium hydrogensulfate?

The molecular weight of Tetrapropyl ammonium hydrogensulfate is 283.43 g/mol.

What are some synonyms for Tetrapropyl ammonium hydrogensulfate?

Some synonyms for Tetrapropyl ammonium hydrogensulfate include Tetrapropylammonium bisulfate, Tetrapropyl ammonium hydrogen sulphate, and tetra-n-propylammonium hydrogen sulfate.

What is the IUPAC name of Tetrapropyl ammonium hydrogensulfate?

The IUPAC name of Tetrapropyl ammonium hydrogensulfate is hydrogen sulfate;tetrapropylazanium.

What is the Canonical SMILES representation of Tetrapropyl ammonium hydrogensulfate?

The Canonical SMILES representation of Tetrapropyl ammonium hydrogensulfate is CCC[N+](CCC)(CCC)CCC.OS(=O)(=O)[O-].

How many hydrogen bond donor counts are there in Tetrapropyl ammonium hydrogensulfate?

There is 1 hydrogen bond donor count in Tetrapropyl ammonium hydrogensulfate.

What is the topological polar surface area of Tetrapropyl ammonium hydrogensulfate?

The topological polar surface area of Tetrapropyl ammonium hydrogensulfate is 85.8 Å^2.

Is Tetrapropyl ammonium hydrogensulfate a canonicalized compound?

Yes, Tetrapropyl ammonium hydrogensulfate is a canonicalized compound.

How many rotatable bond counts are there in Tetrapropyl ammonium hydrogensulfate?

There are 8 rotatable bond counts in Tetrapropyl ammonium hydrogensulfate.

What is the exact mass and the monoisotopic mass of Tetrapropyl ammonium hydrogensulfate?

The exact mass and monoisotopic mass of Tetrapropyl ammonium hydrogensulfate are both 283.18172958 g/mol.