What is the molecular formula of Tetraphenylsilane?
The molecular formula of Tetraphenylsilane is C24H20Si.
What is the molecular weight of Tetraphenylsilane?
The molecular weight of Tetraphenylsilane is 336.5 g/mol.
When was Tetraphenylsilane created?
Tetraphenylsilane was created on March 26, 2005.
What is the IUPAC Name of Tetraphenylsilane?
The IUPAC Name of Tetraphenylsilane is tetraphenylsilane.
What is the InChI of Tetraphenylsilane?
The InChI of Tetraphenylsilane is InChI=1S/C24H20Si/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H.
What is the InChIKey of Tetraphenylsilane?
The InChIKey of Tetraphenylsilane is JLAVCPKULITDHO-UHFFFAOYSA-N.
What is the canonical SMILES of Tetraphenylsilane?
The canonical SMILES of Tetraphenylsilane is C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.
What is the CAS number of Tetraphenylsilane?
The CAS number of Tetraphenylsilane is 1048-08-4.
Is Tetraphenylsilane a canonicalized compound?
Yes, Tetraphenylsilane is a canonicalized compound.