What is the molecular formula of Tetraisopropoxysilane?
The molecular formula of Tetraisopropoxysilane is C12H28O4Si.
What is the molecular weight of Tetraisopropoxysilane?
The molecular weight of Tetraisopropoxysilane is 264.43 g/mol.
What is the IUPAC name of Tetraisopropoxysilane?
The IUPAC name of Tetraisopropoxysilane is tetrapropan-2-yl silicate.
What is the InChI of Tetraisopropoxysilane?
The InChI of Tetraisopropoxysilane is InChI=1S/C12H28O4Si/c1-9(2)13-17(14-10(3)4,15-11(5)6)16-12(7)8/h9-12H,1-8H3.
What is the InChIKey of Tetraisopropoxysilane?
The InChIKey of Tetraisopropoxysilane is ZUEKXCXHTXJYAR-UHFFFAOYSA-N.
What is the canonical SMILES of Tetraisopropoxysilane?
The canonical SMILES of Tetraisopropoxysilane is CC(C)O[Si](OC(C)C)(OC(C)C)OC(C)C.
What is the CAS number of Tetraisopropoxysilane?
The CAS number of Tetraisopropoxysilane is 1992-48-9.
What is the European Community (EC) Number of Tetraisopropoxysilane?
The European Community (EC) Number of Tetraisopropoxysilane is 217-875-1.
What is the UNII of Tetraisopropoxysilane?
The UNII of Tetraisopropoxysilane is LR8KE994HL.
What is the Nikkaji Number of Tetraisopropoxysilane?
The Nikkaji Number of Tetraisopropoxysilane is J135.394B.