429-07-2 Purity
≥98%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of tetrabutylammonium fluoride is C16H36FN.
The molecular weight of tetrabutylammonium fluoride is 261.46 g/mol.
Tetrabutylammonium fluoride has a role as a phase-transfer catalyst.
The IUPAC name of tetrabutylammonium fluoride is tetrabutylazanium fluoride.
The InChIKey of tetrabutylammonium fluoride is FPGGTKZVZWFYPV-UHFFFAOYSA-M.
The Canonical SMILES of tetrabutylammonium fluoride is CCCC[N+](CCCC)(CCCC)CCCC.[F-].
The CAS number for tetrabutylammonium fluoride is 429-41-4.
Tetrabutylammonium fluoride has 0 hydrogen bond donor counts.
Tetrabutylammonium fluoride has 1 hydrogen bond acceptor count.
The topological polar surface area of tetrabutylammonium fluoride is 0-2.