What is the molecular formula of suberic acid?
The molecular formula of suberic acid is C8H14O4.
What are the synonyms for suberic acid?
The synonyms for suberic acid include octanedioic acid, 505-48-6, 1,8-octanedioic acid, and cork acid.
What is the molecular weight of suberic acid?
The molecular weight of suberic acid is 174.19 g/mol.
What is the IUPAC name of suberic acid?
The IUPAC name of suberic acid is octanedioic acid.
What is the InChI of suberic acid?
The InChI of suberic acid is InChI=1S/C8H14O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H,9,10)(H,11,12).
What is the InChIKey of suberic acid?
The InChIKey of suberic acid is TYFQFVWCELRYAO-UHFFFAOYSA-N.
What is the CAS number of suberic acid?
The CAS number of suberic acid is 505-48-6.
How many hydrogen bond donor counts does suberic acid have?
Suberic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does suberic acid have?
Suberic acid has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does suberic acid have?
Suberic acid has 7 rotatable bond counts.