What is the CAS number for Stearyl heptanoate?
The CAS number for Stearyl heptanoate is 66009-41-4.
What are some synonyms for Stearyl heptanoate?
Some synonyms for Stearyl heptanoate are Heptanoic acid, octadecyl ester and Octadecyl heptanoate.
What is the IUPAC name for Stearyl heptanoate?
The IUPAC name for Stearyl heptanoate is Octadecyl heptanoate.
What is the molecular weight of Stearyl heptanoate?
The molecular weight of Stearyl heptanoate is 382.66.
What is the molecular formula of Stearyl heptanoate?
The molecular formula of Stearyl heptanoate is C25H50O2.
Can you provide the SMILES notation for Stearyl heptanoate?
The SMILES notation for Stearyl heptanoate is CCCCCCCCCCCCCCCCCCOC(=O)CCCCCC.
What is the InChI Key for Stearyl heptanoate?
The InChI Key for Stearyl heptanoate is InChI=1S/C25H50O2/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-22-24-27-25(26)23-21-8-6-4-2/h3-24H2,1-2H3.
What is the percentage of actives in Stearyl heptanoate?
The percentage of actives in Stearyl heptanoate is 95%.
What is the physical state of Stearyl heptanoate?
The physical state of Stearyl heptanoate is solid.
What are some typical applications of Stearyl heptanoate?
Some typical applications of Stearyl heptanoate are its use as a dispersing agent, emulsion stabilizer, and lubricant.