What is the molecular formula of Sodium(2-thienyl)dimethylsilanolate?
The molecular formula is C6H9NaOSSi.
What are the synonyms for Sodium(2-thienyl)dimethylsilanolate?
The synonyms are SODIUM (THIEN-2-YL)DIMETHYLSILANOLATE, 879904-87-7, sodium;dimethyl-oxido-thiophen-2-ylsilane, Sodium dimethyl(thiophen-2-yl)silanolate, and Sodium(2-thienyl)dimethylsilanolate.
What is the molecular weight of Sodium(2-thienyl)dimethylsilanolate?
The molecular weight is 180.28 g/mol.
What is the parent compound of Sodium(2-thienyl)dimethylsilanolate?
The parent compound is CID 11469220 (Dimethyl(2-thienyl)silanol).
What are the component compounds of Sodium(2-thienyl)dimethylsilanolate?
The component compounds are CID 11469220 (Dimethyl(2-thienyl)silanol) and CID 5360545 (Sodium).
What is the IUPAC name of Sodium(2-thienyl)dimethylsilanolate?
The IUPAC name is sodium;dimethyl-oxido-thiophen-2-ylsilane.
What is the InChI of Sodium(2-thienyl)dimethylsilanolate?
The InChI is InChI=1S/C6H9OSSi.Na/c1-9(2,7)6-4-3-5-8-6;/h3-5H,1-2H3;/q-1;+1.
What is the InChIKey of Sodium(2-thienyl)dimethylsilanolate?
The InChIKey is NMQRTKBUTWSOFY-UHFFFAOYSA-N.
What is the canonical SMILES of Sodium(2-thienyl)dimethylsilanolate?
The canonical SMILES is C[Si](C)(C1=CC=CS1)[O-].[Na+].
What is the CAS number of Sodium(2-thienyl)dimethylsilanolate?
The CAS number is 879904-87-7.
※ Please kindly note that our products are for research use only.