What is the molecular formula of quinoxaline N-oxide?
The molecular formula of quinoxaline N-oxide is C8H6N2O.
What is the molecular weight of quinoxaline N-oxide?
The molecular weight of quinoxaline N-oxide is 146.15 g/mol.
What is the IUPAC name of quinoxaline N-oxide?
The IUPAC name of quinoxaline N-oxide is 1-oxidoquinoxalin-1-ium.
What is the InChI of quinoxaline N-oxide?
The InChI of quinoxaline N-oxide is InChI=1S/C8H6N2O/c11-10-6-5-9-7-3-1-2-4-8(7)10/h1-6H.
What is the InChIKey of quinoxaline N-oxide?
The InChIKey of quinoxaline N-oxide is OARGFWQSVACNCO-UHFFFAOYSA-N.
What is the canonical SMILES of quinoxaline N-oxide?
The canonical SMILES of quinoxaline N-oxide is C1=CC=C2C(=C1)N=CC=[N+]2[O-].
What is the CAS number of quinoxaline N-oxide?
The CAS number of quinoxaline N-oxide is 6935-29-1.
What is the European Community (EC) number of quinoxaline N-oxide?
The European Community (EC) number of quinoxaline N-oxide is 623-145-7.
What is the UNII of quinoxaline N-oxide?
The UNII of quinoxaline N-oxide is NWY6JJ9HR6.
What is the XLogP3-AA value of quinoxaline N-oxide?
The XLogP3-AA value of quinoxaline N-oxide is 0.2.