1019842-99-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The PubChem CID of the compound is 636283.
The molecular formula of the compound is C36H44N4Pt.
The synonyms of the compound are PtOEP, 31248-39-2, Platinum octaethylporphyrin, MFCD00672301, 2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide, and platinum(2+).
The molecular weight of the compound is 727.8 g/mol.
The parent compound of the compound is CID 102311, which is 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine.
The component compounds of the compound are Platinum (CID 23939) and 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine (CID 102311).
The IUPAC name of the compound is 2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide;platinum(2+).
The InChI of the compound is InChI=1S/C36H44N4.Pt/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-20H,9-16H2,1-8H3;/q-2;+2.
The InChIKey of the compound is WAODGUVBNLMTSF-UHFFFAOYSA-N.
Yes, the compound is canonicalized.