What is the molecular formula of Potassium caprate?
The molecular formula of Potassium caprate is C10H19KO2.
What is the molecular weight of Potassium caprate?
The molecular weight of Potassium caprate is 210.35 g/mol.
What is the IUPAC name of Potassium caprate?
The IUPAC name of Potassium caprate is potassium;decanoate.
What is the InChI of Potassium caprate?
The InChI of Potassium caprate is InChI=1S/C10H20O2.K/c1-2-3-4-5-6-7-8-9-10(11)12;/h2-9H2,1H3,(H,11,12);/q;+1/p-1.
What is the InChIKey of Potassium caprate?
The InChIKey of Potassium caprate is QDIGBJJRWUZARS-UHFFFAOYSA-M.
What is the canonical SMILES of Potassium caprate?
The canonical SMILES of Potassium caprate is CCCCCCCCCC(=O)[O-].[K+].
What is the CAS number of Potassium caprate?
The CAS number of Potassium caprate is 13040-18-1.
What is the European Community (EC) number of Potassium caprate?
The European Community (EC) number of Potassium caprate is 235-910-9.
What is the ChEMBL ID of Potassium caprate?
The ChEMBL ID of Potassium caprate is CHEMBL3910243.
Is Potassium caprate a canonicalized compound?
Yes, Potassium caprate is a canonicalized compound according to PubChem.