What is the molecular formula of potassium 3-bromophenyltrifluoroborate?
The molecular formula is C6H4BBrF3K.
What are the synonyms for potassium 3-bromophenyltrifluoroborate?
The synonyms are Potassium (3-bromophenyl)trifluoroborate, Potassium 3-bromophenyltrifluoroborate, potassium;(3-bromophenyl)-trifluoroboranuide, and POTASSIUM (3-BROMOPHENYL)TRIFLUOROBORANUIDE.
What is the molecular weight of potassium 3-bromophenyltrifluoroborate?
The molecular weight is 262.91 g/mol.
What is the parent compound of potassium 3-bromophenyltrifluoroborate?
The parent compound is CID 17748109 ((3-Bromophenyl)-trifluoroboranuide).
What are the component compounds of potassium 3-bromophenyltrifluoroborate?
The component compounds are CID 5462222 (Potassium) and CID 17748109 ((3-Bromophenyl)-trifluoroboranuide).
What is the IUPAC name of potassium 3-bromophenyltrifluoroborate?
The IUPAC name is potassium;(3-bromophenyl)-trifluoroboranuide.
What is the InChI of potassium 3-bromophenyltrifluoroborate?
The InChI is InChI=1S/C6H4BBrF3.K/c8-6-3-1-2-5(4-6)7(9,10)11;/h1-4H;/q-1;+1.
What is the InChIKey of potassium 3-bromophenyltrifluoroborate?
The InChIKey is NIDYRVJZTADCGO-UHFFFAOYSA-N.
What is the canonical SMILES of potassium 3-bromophenyltrifluoroborate?
The canonical SMILES is [B-](C1=CC(=CC=C1)Br)(F)(F)F.[K+].
What is the CAS number of potassium 3-bromophenyltrifluoroborate?
The CAS number is 374564-34-8.
※ Please kindly note that our products are for research use only.