What is the CAS number for Phenyl Diphenylphosphinite?
The CAS number for Phenyl Diphenylphosphinite is 13360-92-4.
What is the Canonical SMILES for Phenyl Diphenylphosphinite?
The Canonical SMILES for Phenyl Diphenylphosphinite is C1=CC=C(C=C1)OP(C2=CC=CC=C2)C3=CC=CC=C3.
How many heavy atoms are present in the computed properties of Phenyl Diphenylphosphinite?
There are 20 heavy atoms present in the computed properties of Phenyl Diphenylphosphinite.
What is the XLogP3 value for Phenyl Diphenylphosphinite?
The XLogP3 value for Phenyl Diphenylphosphinite is 4.9.
What is the molecular formula of Phenyl Diphenylphosphinite?
The molecular formula of Phenyl Diphenylphosphinite is C18H15OP.
What is the exact mass of Phenyl Diphenylphosphinite?
The exact mass of Phenyl Diphenylphosphinite is 278.086052095 g/mol.
What is the IUPAC name of Phenyl Diphenylphosphinite?
The IUPAC name of Phenyl Diphenylphosphinite is phenoxy(diphenyl)phosphane.
What is the InChIKey for Phenyl Diphenylphosphinite?
The InChIKey for Phenyl Diphenylphosphinite is UPDNYUVJHQABBS-UHFFFAOYSA-N.
How many rotatable bonds are present in the computed properties of Phenyl Diphenylphosphinite?
There are 4 rotatable bonds present in the computed properties of Phenyl Diphenylphosphinite.
What are some of the depositor-supplied synonyms for Phenyl Diphenylphosphinite?
Some depositor-supplied synonyms for Phenyl Diphenylphosphinite are Phenoxydiphenylphosphine, Phenyldiphenylphosphinite, and Phosphinous acid, diphenyl-, phenyl ester.
※ Please kindly note that our products are for research use only.