What is the molecular formula of Phenoxodiol?
The molecular formula of Phenoxodiol is C15H12O3.
What are some synonyms for Phenoxodiol?
Some synonyms for Phenoxodiol include Idronoxil, Dehydroequol, and Haginin E.
What is the molecular weight of Phenoxodiol?
The molecular weight of Phenoxodiol is 240.25 g/mol.
When was Phenoxodiol created and last modified?
Phenoxodiol was created on July 19, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Phenoxodiol?
The IUPAC name of Phenoxodiol is 3-(4-hydroxyphenyl)-2H-chromen-7-ol.
What is the InChIKey of Phenoxodiol?
The InChIKey of Phenoxodiol is ZZUBHVMHNVYXRR-UHFFFAOYSA-N.
What is the Canonical SMILES of Phenoxodiol?
The Canonical SMILES of Phenoxodiol is C1C(=CC2=C(O1)C=C(C=C2)O)C3=CC=C(C=C3)O.
What is the CAS number of Phenoxodiol?
The CAS number of Phenoxodiol is 81267-65-4.
How many hydrogen bond donor counts does Phenoxodiol have?
Phenoxodiol has 2 hydrogen bond donor counts.
What is the topological polar surface area of Phenoxodiol?
The topological polar surface area of Phenoxodiol is 49.7 Å2.