What is the molecular formula of pentadecane-1,3-diol?
The molecular formula of pentadecane-1,3-diol is C15H32O2.
What are the synonyms of pentadecane-1,3-diol?
The synonyms of pentadecane-1,3-diol are 66271-79-2, SCHEMBL258060, BS-47550, and F77206.
What is the molecular weight of pentadecane-1,3-diol?
The molecular weight of pentadecane-1,3-diol is 244.41 g/mol.
When was pentadecane-1,3-diol created?
Pentadecane-1,3-diol was created on December 4, 2011.
When was pentadecane-1,3-diol last modified?
Pentadecane-1,3-diol was last modified on October 21, 2023.
What is the IUPAC name of pentadecane-1,3-diol?
The IUPAC name of pentadecane-1,3-diol is pentadecane-1,3-diol.
What is the InChI of pentadecane-1,3-diol?
The InChI of pentadecane-1,3-diol is InChI=1S/C15H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-15(17)13-14-16/h15-17H,2-14H2,1H3.
What is the InChIKey of pentadecane-1,3-diol?
The InChIKey of pentadecane-1,3-diol is UGJRMHXEWBBMMN-UHFFFAOYSA-N.
What is the canonical SMILES of pentadecane-1,3-diol?
The canonical SMILES of pentadecane-1,3-diol is CCCCCCCCCCCC(CCO)O.
What is the XLogP3-AA value of pentadecane-1,3-diol?
The XLogP3-AA value of pentadecane-1,3-diol is 5.4.