What is the molecular formula of p-Tolyltrimethylsilane?
The molecular formula of p-Tolyltrimethylsilane is C10H16Si.
What is the molecular weight of p-Tolyltrimethylsilane?
The molecular weight of p-Tolyltrimethylsilane is 164.32 g/mol.
What is the IUPAC name of p-Tolyltrimethylsilane?
The IUPAC name of p-Tolyltrimethylsilane is trimethyl-(4-methylphenyl)silane.
What is the InChI of p-Tolyltrimethylsilane?
The InChI of p-Tolyltrimethylsilane is InChI=1S/C10H16Si/c1-9-5-7-10(8-6-9)11(2,3)4/h5-8H,1-4H3.
What is the InChIKey of p-Tolyltrimethylsilane?
The InChIKey of p-Tolyltrimethylsilane is QGHURGPPCGMAMZ-UHFFFAOYSA-N.
What is the canonical SMILES of p-Tolyltrimethylsilane?
The canonical SMILES of p-Tolyltrimethylsilane is CC1=CC=C(C=C1)[Si](C)(C)C.
What is the CAS number of p-Tolyltrimethylsilane?
The CAS number of p-Tolyltrimethylsilane is 3728-43-6.
What is the EC number of p-Tolyltrimethylsilane?
The EC number of p-Tolyltrimethylsilane is 680-705-3.
What is the DSSTox Substance ID of p-Tolyltrimethylsilane?
The DSSTox Substance ID of p-Tolyltrimethylsilane is DTXSID00305249.
Is p-Tolyltrimethylsilane a canonicalized compound?
Yes, p-Tolyltrimethylsilane is a canonicalized compound.