What is the molecular formula of Octyltriethoxysilane?
The molecular formula of Octyltriethoxysilane is C14H32O3Si.
What is the molecular weight of Octyltriethoxysilane?
The molecular weight of Octyltriethoxysilane is 276.49 g/mol.
What are some synonyms of Octyltriethoxysilane?
Some synonyms of Octyltriethoxysilane are Triethoxyoctylsilane, n-Octyltriethoxysilane, and Triethoxy(octyl)silane.
When was Octyltriethoxysilane created and modified?
Octyltriethoxysilane was created on March 26, 2005, and last modified on November 25, 2023.
What is the IUPAC name of Octyltriethoxysilane?
The IUPAC name of Octyltriethoxysilane is triethoxy(octyl)silane.
What is the InChIKey of Octyltriethoxysilane?
The InChIKey of Octyltriethoxysilane is MSRJTTSHWYDFIU-UHFFFAOYSA-N.
What is the canonical SMILES of Octyltriethoxysilane?
The canonical SMILES of Octyltriethoxysilane is CCCCCCCC[Si](OCC)(OCC)OCC.
What is the CAS number of Octyltriethoxysilane?
The CAS number of Octyltriethoxysilane is 2943-75-1.
What is the molecular weight of Octyltriethoxysilane according to PubChem?
The molecular weight of Octyltriethoxysilane is 276.49 g/mol according to PubChem.
How many rotatable bonds does Octyltriethoxysilane have?
Octyltriethoxysilane has 13 rotatable bonds.