What is the molecular formula of naxagolide hydrochloride?
The molecular formula of naxagolide hydrochloride is C15H22ClNO2.
What is the molecular weight of naxagolide hydrochloride?
The molecular weight of naxagolide hydrochloride is 283.79 g/mol.
What is the PubChem CID of naxagolide hydrochloride?
The PubChem CID of naxagolide hydrochloride is 57532.
When was naxagolide hydrochloride created?
Naxagolide hydrochloride was created on August 8, 2005.
What is the structure of naxagolide hydrochloride?
The structure of naxagolide hydrochloride is not provided in the reference.
What are the synonyms of naxagolide hydrochloride?
The synonyms of naxagolide hydrochloride include NAXAGOLIDE HYDROCHLORIDE, 99705-65-4, Naxagolide HCl, 100935-99-7, ent Naxagolide Hydrochloride, and more.
What is the IUPAC name of naxagolide hydrochloride?
The IUPAC name of naxagolide hydrochloride is (4aR,10bR)-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-9-ol;hydrochloride.
What is the InChIKey of naxagolide hydrochloride?
The InChIKey of naxagolide hydrochloride is NNEACMQMRLNNIL-CTHHTMFSSA-N.
What is the canonical SMILES of naxagolide hydrochloride?
The canonical SMILES of naxagolide hydrochloride is CCCN1CCOC2C1CCC3=C2C=C(C=C3)O.Cl.
What is the CAS number of naxagolide hydrochloride?
The CAS number of naxagolide hydrochloride is 99705-65-4.