What is the molecular formula of Naphthol AS-E?
The molecular formula of Naphthol AS-E is C17H12ClNO2.
What is the molecular weight of Naphthol AS-E?
The molecular weight of Naphthol AS-E is 297.7 g/mol.
What is the IUPAC name of Naphthol AS-E?
The IUPAC name of Naphthol AS-E is N-(4-chlorophenyl)-3-hydroxynaphthalene-2-carboxamide.
What is the InChI of Naphthol AS-E?
The InChI of Naphthol AS-E is InChI=1S/C17H12ClNO2/c18-13-5-7-14(8-6-13)19-17(21)15-9-11-3-1-2-4-12(11)10-16(15)20/h1-10,20H,(H,19,21).
What is the InChIKey of Naphthol AS-E?
The InChIKey of Naphthol AS-E is OHAXNCGNVGGWSO-UHFFFAOYSA-N.
What is the canonical SMILES of Naphthol AS-E?
The canonical SMILES of Naphthol AS-E is C1=CC=C2C=C(C(=CC2=C1)C(=O)NC3=CC=C(C=C3)Cl)O.
What is the CAS number of Naphthol AS-E?
The CAS number of Naphthol AS-E is 92-78-4.
What is the European Community (EC) number of Naphthol AS-E?
The European Community (EC) number of Naphthol AS-E is 202-189-7.
What is the UNII of Naphthol AS-E?
The UNII of Naphthol AS-E is 8V561WAE43.
What is the ChEMBL ID of Naphthol AS-E?
The ChEMBL ID of Naphthol AS-E is CHEMBL65653.
What is the InChI code of Naphthol AS-E?
The InChI code of Naphthol AS-E is InChI=1S/C17H12ClNO2/c18-13-5-7-14(8-6-13)19-17(21)15-9-11-3-1-2-4-12(11)10-16(15)20/h1-10,20H,(H,19,21).
What is the topological polar surface area of Naphthol AS-E?
The topological polar surface area of Naphthol AS-E is 49.3?2.