What is the molecular formula of Moracin O?
The molecular formula of Moracin O is C19H18O5.
What is the molecular weight of Moracin O?
The molecular weight of Moracin O is 326.3 g/mol.
What is the IUPAC name of Moracin O?
The IUPAC name of Moracin O is 5-[(6R)-6-(2-hydroxypropan-2-yl)-5,6-dihydrofuro[3,2-f][1]benzofuran-2-yl]benzene-1,3-diol.
What is the InChI key of Moracin O?
The InChI key of Moracin O is HMTMYIWMPJSCAZ-GOSISDBHSA-N.
What is the Canonical SMILES of Moracin O?
The Canonical SMILES of Moracin O is CC(C)(C1CC2=C(O1)C=C3C(=C2)C=C(O3)C4=CC(=CC(=C4)O)O).
What is the CAS number of Moracin O?
The CAS number of Moracin O is 123702-97-6.
How many hydrogen bond donor counts does Moracin O have?
Moracin O has 3 hydrogen bond donor counts.
What is the XLogP3-AA value of Moracin O?
The XLogP3-AA value of Moracin O is 3.3.
What is the topological polar surface area of Moracin O?
The topological polar surface area of Moracin O is 83.1 Ų.
How many heavy atom counts does Moracin O have?
Moracin O has 24 heavy atom counts.