What is the molecular formula of Methyltri-N-hexylsilane?
The molecular formula of Methyltri-N-hexylsilane is C19H42Si.
What is the synonym for Methyltri-N-hexylsilane?
The synonym for Methyltri-N-hexylsilane is trihexyl(methyl)silane.
What is the molecular weight of Methyltri-N-hexylsilane?
The molecular weight of Methyltri-N-hexylsilane is 298.6 g/mol.
What is the IUPAC name of Methyltri-N-hexylsilane?
The IUPAC name of Methyltri-N-hexylsilane is trihexyl(methyl)silane.
What is the InChI of Methyltri-N-hexylsilane?
The InChI of Methyltri-N-hexylsilane is InChI=1S/C19H42Si/c1-5-8-11-14-17-20(4,18-15-12-9-6-2)19-16-13-10-7-3/h5-19H2,1-4H3.
What is the InChIKey of Methyltri-N-hexylsilane?
The InChIKey of Methyltri-N-hexylsilane is MUIDDQWFOHFBAF-UHFFFAOYSA-N.
What is the canonical SMILES of Methyltri-N-hexylsilane?
The canonical SMILES of Methyltri-N-hexylsilane is CCCCCC[Si](C)(CCCCCC)CCCCCC.
How many hydrogen bond donor counts does Methyltri-N-hexylsilane have?
Methyltri-N-hexylsilane has 0 hydrogen bond donor counts.
How many rotatable bond counts does Methyltri-N-hexylsilane have?
Methyltri-N-hexylsilane has 15 rotatable bond counts.
Is Methyltri-N-hexylsilane a canonicalized compound?
Yes, Methyltri-N-hexylsilane is a canonicalized compound.