What is the molecular formula of methyl lactoside?
The molecular formula of methyl lactoside is C13H24O11.
What are the synonyms of methyl lactoside?
The synonyms of methyl lactoside are Methyl beta-lactoside, BETA-METHYLLACTOSIDE, and Methyl-beta-lactoside.
What is the molecular weight of methyl lactoside?
The molecular weight of methyl lactoside is 356.32 g/mol.
How is methyl lactoside described?
Methyl lactoside is described as a methyl glycoside comprising methyl beta-D-glucoside having a beta-D-galactosyl residue at the 4-position. It is functionally related to beta-lactose.
What is the IUPAC name of methyl lactoside?
The IUPAC name of methyl lactoside is (2S,3R,4S,5R,6R)-2-[(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
What is the InChI of methyl lactoside?
The InChI of methyl lactoside is InChI=1S/C13H24O11/c1-21-12-10(20)8(18)11(5(3-15)23-12)24-13-9(19)7(17)6(16)4(2-14)22-13/h4-20H,2-3H2,1H3/t4-,5-,6+,7+,8-,9-,10-,11-,12-,13+/m1/s1.
What is the InChIKey of methyl lactoside?
The InChIKey of methyl lactoside is FHNIYFZSHCGBPP-ABBMIVAOSA-N.
What is the CAS number of methyl lactoside?
The CAS number of methyl lactoside is 7216-69-5.
What is the UNII of methyl lactoside?
The UNII of methyl lactoside is 868YEO5270.
What is the formal charge of methyl lactoside?
The formal charge of methyl lactoside is 0.