What is the molecular formula of Methyl 2-bromo-5-chlorobenzoate?
The molecular formula of Methyl 2-bromo-5-chlorobenzoate is C8H6BrClO2.
What is the molecular weight of Methyl 2-bromo-5-chlorobenzoate?
The molecular weight of Methyl 2-bromo-5-chlorobenzoate is 249.49 g/mol.
What is the IUPAC name of Methyl 2-bromo-5-chlorobenzoate?
The IUPAC name of Methyl 2-bromo-5-chlorobenzoate is methyl 2-bromo-5-chlorobenzoate.
What is the InChI of Methyl 2-bromo-5-chlorobenzoate?
The InChI of Methyl 2-bromo-5-chlorobenzoate is InChI=1S/C8H6BrClO2/c1-12-8(11)6-4-5(10)2-3-7(6)9/h2-4H,1H3.
What is the InChIKey of Methyl 2-bromo-5-chlorobenzoate?
The InChIKey of Methyl 2-bromo-5-chlorobenzoate is BIECSXCXIXHDBC-UHFFFAOYSA-N.
What is the canonical SMILES of Methyl 2-bromo-5-chlorobenzoate?
The canonical SMILES of Methyl 2-bromo-5-chlorobenzoate is COC(=O)C1=C(C=CC(=C1)Cl)Br.
What other identifiers are associated with Methyl 2-bromo-5-chlorobenzoate?
The other identifiers associated with Methyl 2-bromo-5-chlorobenzoate include CAS number: 27007-53-0, European Community (EC) Number: 640-830-6, DSSTox Substance ID: DTXSID70299702, Nikkaji Number: J340.470F, NSC Number: 132246, and Wikidata: Q72488442.
What is the XLogP3 value of Methyl 2-bromo-5-chlorobenzoate?
The XLogP3 value of Methyl 2-bromo-5-chlorobenzoate is 4.1.
Is Methyl 2-bromo-5-chlorobenzoate a canonicalized compound?
Yes, Methyl 2-bromo-5-chlorobenzoate is a canonicalized compound.
※ Please kindly note that our products are for research use only.