1293-87-4 Purity
98.0%(LC)(T)
If you have any other questions or need other size, please get a quote.
Specification
The systematic name of the compound is 2-[2-(2-methoxyethoxy)ethoxy]acetic acid.
The molecular formula of the compound is C7H14O5.
The molecular weight of the compound is 178.18 g/mol.
The InChI of the compound is InChI=1S/C7H14O5/c1-10-2-3-11-4-5-12-6-7(8)9/h2-6H2,1H3,(H,8,9).
The InChIKey of the compound is YHBWXWLDOKIVCJ-UHFFFAOYSA-N.
The CAS number of the compound is 16024-58-1.
The XLogP3-AA value of the compound is -0.6.
The compound has 1 hydrogen bond donor count.
The compound has 5 hydrogen bond acceptor count.
The compound has 8 rotatable bond count.