What is the molecular formula of 2-Methoxyestradiol?
The molecular formula of 2-Methoxyestradiol is C19H26O3.
What is the molecular weight of 2-Methoxyestradiol?
The molecular weight of 2-Methoxyestradiol is 302.4 g/mol.
What is the IUPAC name of 2-Methoxyestradiol?
The IUPAC name of 2-Methoxyestradiol is (8R,9S,13S,14S,17S)-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
What is the InChI of 2-Methoxyestradiol?
The InChI of 2-Methoxyestradiol is InChI=1S/C19H26O3/c1-19-8-7-12-13(15(19)5-6-18(19)21)4-3-11-9-16(20)17(22-2)10-14(11)12/h9-10,12-13,15,18,20-21H,3-8H2,1-2H3/t12-,13+,15-,18-,19-/m0/s1.
What is the InChIKey of 2-Methoxyestradiol?
The InChIKey of 2-Methoxyestradiol is CQOQDQWUFQDJMK-SSTWWWIQSA-N.
What is the Canonical SMILES of 2-Methoxyestradiol?
The Canonical SMILES of 2-Methoxyestradiol is CC12CCC3C(C1CCC2O)CCC4=CC(=C(C=C34)OC)O.
What is the CAS number of 2-Methoxyestradiol?
The CAS number of 2-Methoxyestradiol is 362-07-2.
What is the ChEMBL ID of 2-Methoxyestradiol?
The ChEMBL ID of 2-Methoxyestradiol is CHEMBL299613.
What is the UNII of 2-Methoxyestradiol?
The UNII of 2-Methoxyestradiol is 6I2QW73SR5.
What is the Wikipedia page for 2-Methoxyestradiol?
The Wikipedia page for 2-Methoxyestradiol is "2-Methoxyestradiol".