What is the molecular formula of lithium 2-ethylhexanoate?
The molecular formula of lithium 2-ethylhexanoate is C8H15LiO2.
What is the molecular weight of lithium 2-ethylhexanoate?
The molecular weight of lithium 2-ethylhexanoate is 150.2 g/mol.
What is the IUPAC name of lithium 2-ethylhexanoate?
The IUPAC name of lithium 2-ethylhexanoate is lithium;2-ethylhexanoate.
What is the InChI of lithium 2-ethylhexanoate?
The InChI of lithium 2-ethylhexanoate is InChI=1S/C8H16O2.Li/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+1/p-1.
What is the Canonical SMILES of lithium 2-ethylhexanoate?
The Canonical SMILES of lithium 2-ethylhexanoate is [Li+].CCCCC(CC)C(=O)[O-].
What is the CAS number of lithium 2-ethylhexanoate?
The CAS number of lithium 2-ethylhexanoate is 15590-62-2.
What is the EC (European Community) number of lithium 2-ethylhexanoate?
The EC number of lithium 2-ethylhexanoate is 239-657-5.
What is the Hydrogen Bond Donor Count of lithium 2-ethylhexanoate?
The Hydrogen Bond Donor Count of lithium 2-ethylhexanoate is 0.
What is the Hydrogen Bond Acceptor Count of lithium 2-ethylhexanoate?
The Hydrogen Bond Acceptor Count of lithium 2-ethylhexanoate is 2.
Is lithium 2-ethylhexanoate a canonicalized compound?
Yes, lithium 2-ethylhexanoate is a canonicalized compound.