What is the molecular formula of linagliptin?
The molecular formula of linagliptin is C25H28N8O2.
What is the molecular weight of linagliptin?
The molecular weight of linagliptin is 472.5 g/mol.
When was linagliptin created?
Linagliptin was created on October 25, 2006.
When was linagliptin last modified?
Linagliptin was last modified on November 25, 2023.
What is the IUPAC name of linagliptin?
The IUPAC name of linagliptin is 8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]purine-2,6-dione.
What is the InChI of linagliptin?
The InChI of linagliptin is InChI=1S/C25H28N8O2/c1-4-5-13-32-21-22(29-24(32)31-12-8-9-17(26)14-31)30(3)25(35)33(23(21)34)15-20-27-16(2)18-10-6-7-11-19(18)28-20/h6-7,10-11,17H,8-9,12-15,26H2,1-3H3/t17-/m1/s1.
What is the CAS number of linagliptin?
The CAS number of linagliptin is 668270-12-0.
What is the KEGG ID of linagliptin?
The KEGG ID of linagliptin is D09566.
What is the ChEMBL ID of linagliptin?
The ChEMBL ID of linagliptin is CHEMBL237500.
What is the Wikipedia page for linagliptin?
The Wikipedia page for linagliptin is "Linagliptin".