What is the PubChem CID of Lathosterol?
PubChem CID 65728
What is the molecular formula of Lathosterol?
The molecular formula of Lathosterol is C27H46O.
What are some synonyms of Lathosterol?
Some synonyms of Lathosterol include Lathosterol 80-99-9, 5alpha-Cholest-7-en-3beta-ol, and gamma-Cholesterol.
What is the molecular weight of Lathosterol?
The molecular weight of Lathosterol is 386.7 g/mol.
When was Lathosterol created and last modified in PubChem?
Lathosterol was created on 2004-09-16 and last modified on 2023-11-25.
What is the description of Lathosterol?
Lathosterol is a cholestanoid that is (5alpha)-cholest-7-ene substituted by a beta-hydroxy group at position 3. It has a role as a human metabolite and a mouse metabolite. It is a 3beta-sterol, a cholestanoid, a C27-steroid, and a Delta(7)-sterol.
Where is Lathosterol found in nature?
Lathosterol is found in Smilax perfoliata, Nothoscordum montevidense, and other organisms with available data.
What is the IUPAC Name of Lathosterol?
The IUPAC Name of Lathosterol is (3S,5S,9R,10S,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
What is the InChIKey of Lathosterol?
The InChIKey of Lathosterol is IZVFFXVYBHFIHY-SKCNUYALSA-N.
What is the Canonical SMILES of Lathosterol?
The Canonical SMILES of Lathosterol is CC(C)CCCC(C)C1CCC2C1(CCC3C2=CCC4C3(CCC(C4)O)C).