The molecular formula of Karavilagenin D is C30H46O4.
What is the molecular weight of Karavilagenin D?
The molecular weight of Karavilagenin D is 470.7 g/mol.
When was Karavilagenin D created?
Karavilagenin D was created on June 20, 2012.
When was Karavilagenin D last modified?
Karavilagenin D was last modified on December 30, 2023.
What is the IUPAC name of Karavilagenin D?
The IUPAC name of Karavilagenin D is (1R,4S,5S,8R,9R,12S,13S,16S)-16-hydroxy-8-[(E,2R)-6-hydroxy-6-methylhept-4-en-2-yl]-5,9,17,17-tetramethyl-18-oxapentacyclo[10.5.2.0 1,13 .0 4,12 .0 5,9 ]nonadec-2-en-19-one.
What is the canonical SMILES of Karavilagenin D?
The canonical SMILES of Karavilagenin D is CC(CC=CC(C)(C)O)C1CCC2(C1(CCC34C2C=CC5(C3CCC(C5(C)C)O)OC4=O)C)C.
What is the InChIKey of Karavilagenin D?
The InChIKey of Karavilagenin D is CUJVAMKVNDHSSR-DLGSBZDHSA-N.
What is the hydrogen bond donor count of Karavilagenin D?
The hydrogen bond donor count of Karavilagenin D is 2.
What is the hydrogen bond acceptor count of Karavilagenin D?
The hydrogen bond acceptor count of Karavilagenin D is 4.
What is the rotatable bond count of Karavilagenin D?
The rotatable bond count of Karavilagenin D is 4.
※ Please kindly note that our products are for research use only.