What is the PubChem CID for Hispidin?
PubChem CID 54685921.
What is the molecular formula of Hispidin?
The molecular formula of Hispidin is C13H10O5.
What are the synonyms for Hispidin?
Some synonyms for Hispidin include hispidin, 6-(3,4-dihydroxystyrl)-4-hydroxy-2-pyrone, and 6-(3,4-Dihydroxystyryl)-4-hydroxy-2-pyrone.
What is the molecular weight of Hispidin?
The molecular weight of Hispidin is 246.21 g/mol.
Where is Hispidin found?
Hispidin is a natural product found in Sanghuangporus baumii, Tropicoporus linteus, and other organisms with available data.
What is the IUPAC name of Hispidin?
The IUPAC name of Hispidin is 6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxypyran-2-one.
What is the InChI of Hispidin?
The InChI of Hispidin is InChI=1S/C13H10O5/c14-9-6-10(18-13(17)7-9)3-1-8-2-4-11(15)12(16)5-8/h1-7,14-16H/b3-1+.
What is the Canonical SMILES of Hispidin?
The Canonical SMILES of Hispidin is C1=CC(=C(C=C1C=CC2=CC(=CC(=O)O2)O)O)O.
What is the CAS number of Hispidin?
The CAS number of Hispidin is 555-55-5.
What is the XLogP3-AA value of Hispidin?
The XLogP3-AA value of Hispidin is 1.7.