What is the molecular formula of Fluorescent Brightener OB-1?
The molecular formula of Fluorescent Brightener OB-1 is C28H18N2O2.
What is the molecular weight of Fluorescent Brightener OB-1?
The molecular weight of Fluorescent Brightener OB-1 is 414.5 g/mol.
What is the IUPAC name of Fluorescent Brightener OB-1?
The IUPAC name of Fluorescent Brightener OB-1 is 2-[4-[(E)-2-[4-(1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole.
What is the InChI of Fluorescent Brightener OB-1?
The InChI of Fluorescent Brightener OB-1 is InChI=1S/C28H18N2O2/c1-3-7-25-23(5-1)29-27(31-25)21-15-11-19(12-16-21)9-10-20-13-17-22(18-14-20)28-30-24-6-2-4-8-26(24)32-28/h1-18H/b10-9+.
What are the synonyms of Fluorescent Brightener OB-1?
The synonyms of Fluorescent Brightener OB-1 are 1533-45-5, 4,4'-Bis(2-benzoxazolyl)stilbene, 2,2'-(1,2-Ethenediyldi-4,1-phenylene)bisbenzoxazole, and 1,2-Bis(4-(benzo[d]oxazol-2-yl)phenyl)ethene.
What is the CAS number of Fluorescent Brightener OB-1?
The CAS number of Fluorescent Brightener OB-1 is 1533-45-5.
What is the XLogP3-AA value of Fluorescent Brightener OB-1?
The XLogP3-AA value of Fluorescent Brightener OB-1 is 7.2.
How many hydrogen bond acceptors are there in Fluorescent Brightener OB-1?
There are 4 hydrogen bond acceptors in Fluorescent Brightener OB-1.
What is the topological polar surface area of Fluorescent Brightener OB-1?
The topological polar surface area of Fluorescent Brightener OB-1 is 52.1Ų.
How many rotatable bond counts are there in Fluorescent Brightener OB-1?
The number of rotatable bond counts in Fluorescent Brightener OB-1 is not provided in the reference.
※ Please kindly note that our products are for research use only.