What is the molecular formula of Fipronil-desulfinyl?
The molecular formula of Fipronil-desulfinyl is C12H4Cl2F6N4.
What are some synonyms of Fipronil-desulfinyl?
Some synonyms of Fipronil-desulfinyl include Fipronil Desulfinyl, Desulfinylfipronil, FIPRONIL-DESULFINYL, and Fipronil metabolite 46513.
What is the IUPAC name of Fipronil-desulfinyl?
The IUPAC name of Fipronil-desulfinyl is 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazole-3-carbonitrile.
What is the InChIKey of Fipronil-desulfinyl?
The InChIKey of Fipronil-desulfinyl is JWKXVHLIRTVXLD-UHFFFAOYSA-N.
What is the canonical SMILES of Fipronil-desulfinyl?
The canonical SMILES of Fipronil-desulfinyl is C1=C(C=C(C(=C1Cl)N2C(=C(C(=N2)C#N)C(F)(F)F)N)Cl)C(F)(F)F.
What is the CAS number of Fipronil-desulfinyl?
The CAS number of Fipronil-desulfinyl is 205650-65-3.
What is the molecular weight of Fipronil-desulfinyl?
The molecular weight of Fipronil-desulfinyl is 389.08g/mol.
How many hydrogen bond donor counts does Fipronil-desulfinyl have?
Fipronil-desulfinyl has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Fipronil-desulfinyl have?
Fipronil-desulfinyl has 9 hydrogen bond acceptor counts.
How many rotatable bond counts does Fipronil-desulfinyl have?
Fipronil-desulfinyl has 1 rotatable bond count.