What is the molecular formula of the compound Ethyltriacetoxysilane?
The molecular formula of Ethyltriacetoxysilane is C8H14O6Si.
What is the molecular weight of Ethyltriacetoxysilane?
The molecular weight of Ethyltriacetoxysilane is 234.28 g/mol.
What is the IUPAC name of Ethyltriacetoxysilane?
The IUPAC name of Ethyltriacetoxysilane is [diacetyloxy(ethyl)silyl] acetate.
What is the InChI of Ethyltriacetoxysilane?
The InChI of Ethyltriacetoxysilane is InChI=1S/C8H14O6Si/c1-5-15(12-6(2)9,13-7(3)10)14-8(4)11/h5H2,1-4H3.
What is the InChIKey of Ethyltriacetoxysilane?
The InChIKey of Ethyltriacetoxysilane is KXJLGCBCRCSXQF-UHFFFAOYSA-N.
What is the Canonical SMILES of Ethyltriacetoxysilane?
The Canonical SMILES of Ethyltriacetoxysilane is CC[Si](OC(=O)C)(OC(=O)C)OC(=O)C.
What is the CAS number of Ethyltriacetoxysilane?
The CAS number of Ethyltriacetoxysilane is 17689-77-9.
What is the EC number of Ethyltriacetoxysilane?
The EC number of Ethyltriacetoxysilane is 241-677-4.
What is the ChEMBL ID of Ethyltriacetoxysilane?
The ChEMBL ID of Ethyltriacetoxysilane is CHEMBL3185159.
How many hydrogen bond donor counts does Ethyltriacetoxysilane have?
Ethyltriacetoxysilane has 0 hydrogen bond donor counts.