What is the molecular formula of Ethylenediaminetetraacetic acid tripotassium salt dihydrate?
The molecular formula is C10H17K3N2O10.
What is the molecular weight of Ethylenediaminetetraacetic acid tripotassium salt dihydrate?
The molecular weight is 442.54 g/mol.
What is the IUPAC name of Ethylenediaminetetraacetic acid tripotassium salt dihydrate?
The IUPAC name is tripotassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate;dihydrate.
What is the InChI of Ethylenediaminetetraacetic acid tripotassium salt dihydrate?
The InChI is InChI=1S/C10H16N2O8.3K.2H2O/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;2*1H2/q;3*+1;;/p-3.
What is the InChIKey of Ethylenediaminetetraacetic acid tripotassium salt dihydrate?
The InChIKey is MAPFUJCWRWFQIY-UHFFFAOYSA-K.
What is the canonical SMILES of Ethylenediaminetetraacetic acid tripotassium salt dihydrate?
The canonical SMILES is C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)[O-].O.O.[K+].[K+].[K+].
What is the CAS number of Ethylenediaminetetraacetic acid tripotassium salt dihydrate?
The CAS number is 65501-24-8.
How many hydrogen bond donor counts does Ethylenediaminetetraacetic acid tripotassium salt dihydrate have?
It has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Ethylenediaminetetraacetic acid tripotassium salt dihydrate have?
It has 12 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.