What is the molecular formula of ethyl (E)-3-octenoate?
The molecular formula of ethyl (E)-3-octenoate is C10H18O2.
What is the molecular weight of ethyl (E)-3-octenoate?
The molecular weight of ethyl (E)-3-octenoate is 170.25 g/mol.
What is the IUPAC name of ethyl (E)-3-octenoate?
The IUPAC name of ethyl (E)-3-octenoate is ethyl (E)-oct-3-enoate.
What is the InChI of ethyl (E)-3-octenoate?
The InChI of ethyl (E)-3-octenoate is InChI=1S/C10H18O2/c1-3-5-6-7-8-9-10(11)12-4-2/h7-8H,3-6,9H2,1-2H3/b8-7+.
What is the Computed SMILES of ethyl (E)-3-octenoate?
The Computed SMILES of ethyl (E)-3-octenoate is CCCC/C=C/CC(=O)OCC.
What is the CAS number of ethyl (E)-3-octenoate?
The CAS number of ethyl (E)-3-octenoate is 26553-47-9.
What is the XLogP3-AA value of ethyl (E)-3-octenoate?
The XLogP3-AA value of ethyl (E)-3-octenoate is 3.
How many hydrogen bond donor counts does ethyl (E)-3-octenoate have?
Ethyl (E)-3-octenoate has 0 hydrogen bond donor counts.
How many rotatable bond counts does ethyl (E)-3-octenoate have?
Ethyl (E)-3-octenoate has 7 rotatable bond counts.
What is the topological polar surface area of ethyl (E)-3-octenoate?
The topological polar surface area of ethyl (E)-3-octenoate is 26.32.