What is the molecular formula of (E,Z)-3,13-octadecadienyl acetate?
The molecular formula is C20H36O2.
What is the molecular weight of (E,Z)-3,13-octadecadienyl acetate?
The molecular weight is 308.5 g/mol.
What is the IUPAC name of (E,Z)-3,13-octadecadienyl acetate?
The IUPAC name is [(3E,13Z)-octadeca-3,13-dienyl] acetate.
What is the InChI of (E,Z)-3,13-octadecadienyl acetate?
The InChI is InChI=1S/C20H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20(2)21/h6-7,16-17H,3-5,8-15,18-19H2,1-2H3/b7-6-,17-16+.
What is the InChIKey of (E,Z)-3,13-octadecadienyl acetate?
The InChIKey is VVJPJXKHBZNADP-ZSTZHTMOSA-N.
What are the synonyms of (E,Z)-3,13-octadecadienyl acetate?
The synonyms are 53120-26-6, (E,Z)-3,13-Octadecadienyl acetate, [(3E,13Z)-octadeca-3,13-dienyl] acetate, 3E,13Z-Octadecadienyl acetate, and (E,Z)-3,13-Octadecadien-1-ol acetate.
What is the CAS number of (E,Z)-3,13-octadecadienyl acetate?
The CAS number is 53120-26-6.
How many hydrogen bond donor counts does (E,Z)-3,13-octadecadienyl acetate have?
(E,Z)-3,13-octadecadienyl acetate has 0 hydrogen bond donor counts.
How many rotatable bond counts does (E,Z)-3,13-octadecadienyl acetate have?
(E,Z)-3,13-octadecadienyl acetate has 16 rotatable bond counts.
※ Please kindly note that our products are for research use only.