What is the molecular formula of Dl-1,2-hexanediol?
The molecular formula of Dl-1,2-hexanediol is C6H14O2.
What are the synonyms of Dl-1,2-hexanediol?
The synonyms of Dl-1,2-hexanediol are 1,2-Hexanediol, hexane-1,2-diol, and DL-1,2-Hexanediol.
What is the molecular weight of Dl-1,2-hexanediol?
The molecular weight of Dl-1,2-hexanediol is 118.17 g/mol.
What is the IUPAC name of Dl-1,2-hexanediol?
The IUPAC name of Dl-1,2-hexanediol is hexane-1,2-diol.
What is the InChI of Dl-1,2-hexanediol?
The InChI of Dl-1,2-hexanediol is InChI=1S/C6H14O2/c1-2-3-4-6(8)5-7/h6-8H,2-5H2,1H3.
What is the InChIKey of Dl-1,2-hexanediol?
The InChIKey of Dl-1,2-hexanediol is FHKSXSQHXQEMOK-UHFFFAOYSA-N.
What is the canonical SMILES of Dl-1,2-hexanediol?
The canonical SMILES of Dl-1,2-hexanediol is CCCCC(CO)O.
What is the CAS number of Dl-1,2-hexanediol?
The CAS number of Dl-1,2-hexanediol is 6920-22-5.
What is the XLogP3-AA value of Dl-1,2-hexanediol?
The XLogP3-AA value of Dl-1,2-hexanediol is 0.7.
How many hydrogen bond donors and acceptors are there in Dl-1,2-hexanediol?
Dl-1,2-hexanediol has 2 hydrogen bond donors and 2 hydrogen bond acceptors.