What is the molecular formula of Diphenylcyclopropenone?
The molecular formula of Diphenylcyclopropenone is C15H10O.
What are the synonyms for Diphenylcyclopropenone?
The synonyms for Diphenylcyclopropenone are Diphencyprone and 2,3-Diphenylcycloprop-2-en-1-one.
What is the molecular weight of Diphenylcyclopropenone?
The molecular weight of Diphenylcyclopropenone is 206.24 g/mol.
What is the role of Diphenylcyclopropenone?
Diphenylcyclopropenone has a role as a photosensitizing agent, a hapten, and a drug allergen.
What has Diphenylcyclopropenone been used in trials for?
Diphenylcyclopropenone has been used in trials studying the treatment and basic science of Melanoma, Ultraviolet Rays, Immunosuppression, Neoplasm Metastasis, and Hypersensitivity, Delayed, among others.
What is the IUPAC name of Diphenylcyclopropenone?
The IUPAC name of Diphenylcyclopropenone is 2,3-diphenylcycloprop-2-en-1-one.
What is the InChI of Diphenylcyclopropenone?
The InChI of Diphenylcyclopropenone is InChI=1S/C15H10O/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10H.
What is the InChIKey of Diphenylcyclopropenone?
The InChIKey of Diphenylcyclopropenone is HCIBTBXNLVOFER-UHFFFAOYSA-N.
What is the CAS number of Diphenylcyclopropenone?
The CAS number of Diphenylcyclopropenone is 886-38-4.
What is the ChEMBL ID of Diphenylcyclopropenone?
The ChEMBL ID of Diphenylcyclopropenone is CHEMBL1373467.