What is the molecular formula of Dimethyldiacetoxysilane?
The molecular formula of Dimethyldiacetoxysilane is C6H12O4Si.
What is the molecular weight of Dimethyldiacetoxysilane?
The molecular weight of Dimethyldiacetoxysilane is 176.24 g/mol.
What is the IUPAC name of Dimethyldiacetoxysilane?
The IUPAC name of Dimethyldiacetoxysilane is [acetyloxy(dimethyl)silyl] acetate.
What is the InChI of Dimethyldiacetoxysilane?
The InChI of Dimethyldiacetoxysilane is InChI=1S/C6H12O4Si/c1-5(7)9-11(3,4)10-6(2)8/h1-4H3.
What is the InChIKey of Dimethyldiacetoxysilane?
The InChIKey of Dimethyldiacetoxysilane is RQVFGTYFBUVGOP-UHFFFAOYSA-N.
What is the canonical SMILES of Dimethyldiacetoxysilane?
The canonical SMILES of Dimethyldiacetoxysilane is CC(=O)O[Si](C)(C)OC(=O)C.
What is the CAS number of Dimethyldiacetoxysilane?
The CAS number of Dimethyldiacetoxysilane is 2182-66-3.
What is the European Community (EC) number of Dimethyldiacetoxysilane?
The European Community (EC) number of Dimethyldiacetoxysilane is 218-562-2.
How many hydrogen bond donor counts does Dimethyldiacetoxysilane have?
Dimethyldiacetoxysilane has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Dimethyldiacetoxysilane have?
Dimethyldiacetoxysilane has 4 hydrogen bond acceptor counts.