What is the molecular formula of dimethyl sulfite?
The molecular formula of dimethyl sulfite is C2H6O3S.
What is the molecular weight of dimethyl sulfite?
The molecular weight of dimethyl sulfite is 110.13 g/mol.
What is the IUPAC name of dimethyl sulfite?
The IUPAC name of dimethyl sulfite is dimethyl sulfite.
What is the InChI of dimethyl sulfite?
The InChI of dimethyl sulfite is InChI=1S/C2H6O3S/c1-4-6(3)5-2/h1-2H3.
What is the InChIKey of dimethyl sulfite?
The InChIKey of dimethyl sulfite is BDUPRNVPXOHWIL-UHFFFAOYSA-N.
What is the canonical SMILES of dimethyl sulfite?
The canonical SMILES of dimethyl sulfite is COS(=O)OC.
What is the CAS number of dimethyl sulfite?
The CAS number of dimethyl sulfite is 616-42-2.
What is the European Community (EC) number of dimethyl sulfite?
The European Community (EC) number of dimethyl sulfite is 210-481-0.
What is the UNII of dimethyl sulfite?
The UNII of dimethyl sulfite is 9JFA40S66P.
What is the Wikipedia page for dimethyl sulfite?
The Wikipedia page for dimethyl sulfite can be found under the title "Dimethyl_sulfite".