What is the molecular formula of 3,4-Dimethoxystyrene?
The molecular formula of 3,4-Dimethoxystyrene is C10H12O2.
What is the molecular weight of 3,4-Dimethoxystyrene?
The molecular weight of 3,4-Dimethoxystyrene is 164.20 g/mol.
What is the IUPAC name of 3,4-Dimethoxystyrene?
The IUPAC name of 3,4-Dimethoxystyrene is 4-ethenyl-1,2-dimethoxybenzene.
What is the InChI of 3,4-Dimethoxystyrene?
The InChI of 3,4-Dimethoxystyrene is InChI=1S/C10H12O2/c1-4-8-5-6-9(11-2)10(7-8)12-3/h4-7H,1H2,2-3H3.
What is the InChIKey of 3,4-Dimethoxystyrene?
The InChIKey of 3,4-Dimethoxystyrene is NJXYTXADXSRFTJ-UHFFFAOYSA-N.
What is the canonical SMILES of 3,4-Dimethoxystyrene?
The canonical SMILES of 3,4-Dimethoxystyrene is COC1=C(C=C(C=C1)C=C)OC.
What is the CAS number of 3,4-Dimethoxystyrene?
The CAS number of 3,4-Dimethoxystyrene is 6380-23-0.
What is the molecular weight of 3,4-Dimethoxystyrene according to PubChem?
The molecular weight of 3,4-Dimethoxystyrene according to PubChem is 164.20 g/mol.
What is the XLogP3 value of 3,4-Dimethoxystyrene?
The XLogP3 value of 3,4-Dimethoxystyrene is 2.3.
What is the topological polar surface area of 3,4-Dimethoxystyrene?
The topological polar surface area of 3,4-Dimethoxystyrene is 18.5Ų.