What is the molecular formula of Diethylaminodimethylsilane?
The molecular formula is C6H16NSi.
What are the synonyms for Diethylaminodimethylsilane?
The synonyms are Dimethylsilyldiethylamine, Silanamine, N,N-diethyl-1,1-dimethyl-, N,N-Diethyl-1,1-dimethylsilylamine, Silanamine, N,N-diethyl-1,1-dimethyl.
What is the molecular weight of Diethylaminodimethylsilane?
The molecular weight is 130.28 g/mol.
What is the InChI of Diethylaminodimethylsilane?
The InChI is InChI=1S/C6H16NSi/c1-5-7(6-2)8(3)4/h5-6H2,1-4H3.
What is the InChIKey of Diethylaminodimethylsilane?
The InChIKey is ADTGAVILDBXARD-UHFFFAOYSA-N.
What is the canonical SMILES of Diethylaminodimethylsilane?
The canonical SMILES is CCN(CC)[Si](C)C.
What is the CAS number of Diethylaminodimethylsilane?
The CAS number is 13686-66-3.
What is the European Community (EC) number of Diethylaminodimethylsilane?
The EC number is 237-202-5.
What is the DSSTox Substance ID of Diethylaminodimethylsilane?
The DSSTox Substance ID is DTXSID50884630.
Is Diethylaminodimethylsilane a canonicalized compound?
Yes, Diethylaminodimethylsilane is a canonicalized compound.
※ Please kindly note that our products are for research use only.