What is the molecular formula of Di-p-tolylamine?
The molecular formula of Di-p-tolylamine is C14H15N.
What is the molecular weight of Di-p-tolylamine?
The molecular weight of Di-p-tolylamine is 197.27 g/mol.
What are the synonyms of Di-p-tolylamine?
The synonyms of Di-p-tolylamine include 4,4'-Dimethyldiphenylamine, 620-93-9, p,p'-Ditolylamine, and 4-Methyl-N-(4-methylphenyl)aniline.
What is the IUPAC name of Di-p-tolylamine?
The IUPAC name of Di-p-tolylamine is 4-methyl-N-(4-methylphenyl)aniline.
What is the InChI of Di-p-tolylamine?
The InChI of Di-p-tolylamine is InChI=1S/C14H15N/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14/h3-10,15H,1-2H3.
What is the InChIKey of Di-p-tolylamine?
The InChIKey of Di-p-tolylamine is RHPVVNRNAHRJOQ-UHFFFAOYSA-N.
What is the canonical SMILES of Di-p-tolylamine?
The canonical SMILES of Di-p-tolylamine is CC1=CC=C(C=C1)NC2=CC=C(C=C2)C.
What is the CAS number of Di-p-tolylamine?
The CAS number of Di-p-tolylamine is 620-93-9.
What is the European Community (EC) number of Di-p-tolylamine?
The European Community (EC) number of Di-p-tolylamine is 210-659-8.
Is Di-p-tolylamine a canonicalized compound?
Yes, Di-p-tolylamine is a canonicalized compound.