What is the molecular formula of Cyclohexyldiphenylphosphine?
The molecular formula of Cyclohexyldiphenylphosphine is C18H21P.
What is the molecular weight of Cyclohexyldiphenylphosphine?
The molecular weight of Cyclohexyldiphenylphosphine is 268.3 g/mol.
What is the IUPAC name of Cyclohexyldiphenylphosphine?
The IUPAC name of Cyclohexyldiphenylphosphine is cyclohexyl(diphenyl)phosphane.
What is the InChI of Cyclohexyldiphenylphosphine?
The InChI of Cyclohexyldiphenylphosphine is InChI=1S/C18H21P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-2,4-7,10-13,18H,3,8-9,14-15H2.
What is the InChIKey of Cyclohexyldiphenylphosphine?
The InChIKey of Cyclohexyldiphenylphosphine is ZXKWUYWWVSKKQZ-UHFFFAOYSA-N.
What is the canonical SMILES of Cyclohexyldiphenylphosphine?
The canonical SMILES of Cyclohexyldiphenylphosphine is C1CCC(CC1)P(C2=CC=CC=C2)C3=CC=CC=C3.
What is the CAS number of Cyclohexyldiphenylphosphine?
The CAS number of Cyclohexyldiphenylphosphine is 6372-42-5.
What is the European Community (EC) number of Cyclohexyldiphenylphosphine?
The European Community (EC) number of Cyclohexyldiphenylphosphine is 228-904-2.
What is the molecular weight of Cyclohexyldiphenylphosphine calculated by PubChem?
The molecular weight of Cyclohexyldiphenylphosphine calculated by PubChem is 268.3 g/mol.
Is Cyclohexyldiphenylphosphine a canonicalized compound?
Yes, Cyclohexyldiphenylphosphine is a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.