What is the molecular formula of Cycloartenol?
The molecular formula of Cycloartenol is C30H50O.
What is the molecular weight of Cycloartenol?
The molecular weight of Cycloartenol is 426.7 g/mol.
What is the IUPAC name of Cycloartenol?
The IUPAC name of Cycloartenol is (1S,3R,6S,8R,11S,12S,15R,16R)-7,7,12,16-tetramethyl-15-[(2R)-6-methylhept-5-en-2-yl]pentacyclo[9.7.0.0 1,3 .0 3,8 .0 12,16 ]octadecan-6-ol.
What is the InChI of Cycloartenol?
The InChI of Cycloartenol is InChI=1S/C30H50O/c1-20(2)9-8-10-21(3)22-13-15-28(7)24-12-11-23-26(4,5)25(31)14-16-29(23)19-30(24,29)18-17-27(22,28)6/h9,21-25,31H,8,10-19H2,1-7H3/t21-,22-,23+,24+,25+,27-,28+,29-,30+/m1/s1.
What is the InChIKey of Cycloartenol?
The InChIKey of Cycloartenol is ONQRKEUAIJMULO-YBXTVTTCSA-N.
What is the canonical SMILES of Cycloartenol?
The canonical SMILES of Cycloartenol is CC(CCC=C(C)C)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)O)C)C.
What is the isomeric SMILES of Cycloartenol?
The isomeric SMILES of Cycloartenol is C[C@H](CCC=C(C)C)[C@H]1CC[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@@H]5[C@]3(C4)CC[C@@H](C5(C)C)O)C)C.
What are some synonyms of Cycloartenol?
Some synonyms of Cycloartenol are Handianol and 9beta,19-cyclo-24-lanosten-3beta-ol.
What is the CAS number of Cycloartenol?
The CAS number of Cycloartenol is 469-38-5.
Where is Cycloartenol found in nature?
Cycloartenol is found in Euphorbia nicaeensis, Euphorbia boetica, and other organisms.