What is the molecular formula of (S)-(+)-Ketamine hydrochloride?
The molecular formula is C13H17Cl2NO.
What is the molecular weight of (S)-(+)-Ketamine hydrochloride?
The molecular weight is 274.18 g/mol.
What are the synonyms of (S)-(+)-Ketamine hydrochloride?
Some synonyms include Esketamine hydrochloride, esketamine HCl, and Ketanest S.
What is the IUPAC name of (S)-(+)-Ketamine hydrochloride?
The IUPAC name is (2S)-2-(2-chlorophenyl)-2-(methylamino)cyclohexan-1-one;hydrochloride.
What is the InChIKey of (S)-(+)-Ketamine hydrochloride?
The InChIKey is VCMGMSHEPQENPE-ZOWNYOTGSA-N.
What is the Canonical SMILES of (S)-(+)-Ketamine hydrochloride?
The Canonical SMILES is CNC1(CCCCC1=O)C2=CC=CC=C2Cl.Cl.
What is the CAS number of (S)-(+)-Ketamine hydrochloride?
The CAS number is 33643-47-9.
How many hydrogen bond donor counts does (S)-(+)-Ketamine hydrochloride have?
It has 2 hydrogen bond donors.
How many hydrogen bond acceptor counts does (S)-(+)-Ketamine hydrochloride have?
It has 2 hydrogen bond acceptors.
What is the topological polar surface area of (S)-(+)-Ketamine hydrochloride?
The topological polar surface area is 29.1 Å2.