What is the molecular formula of clindamycin?
The molecular formula of clindamycin is C18H33ClN2O5S.
How is clindamycin categorized in terms of its pharmacological effect?
Clindamycin is categorized as a Lincosamide Antibacterial.
What is the FDA Pharm Class of clindamycin?
Clindamycin is classified as a broad spectrum antibiotic used orally, topically, and parenterally for bacterial infections due to sensitive organisms.
How is clindamycin produced?
Clindamycin is a semisynthetic broad spectrum antibiotic produced by chemical modification of the parent compound lincomycin.
What is the IUPAC Name of clindamycin?
The IUPAC Name of clindamycin is (2S,4R)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide.
What is the InChIKey of clindamycin?
The InChIKey of clindamycin is KDLRVYVGXIQJDK-AWPVFWJPSA-N.
What is the Canonical SMILES representation of clindamycin?
The Canonical SMILES of clindamycin is CCCC1CC(N(C1)C)C(=O)NC(C2C(C(C(C(O2)SC)O)O)O)C(C)Cl.
What is the CAS number of clindamycin?
The CAS number of clindamycin is 18323-44-9.
How many hydrogen bond donor counts does clindamycin have?
Clindamycin has a hydrogen bond donor count of 4.
What is the XLogP3 value of clindamycin?
The XLogP3 value of clindamycin is 2.2.