What is the molecular formula of menthyl anthranilate?
The molecular formula of menthyl anthranilate is C17H25NO2.
What is the molecular weight of menthyl anthranilate?
The molecular weight of menthyl anthranilate is 275.4 g/mol.
What is the IUPAC name of menthyl anthranilate?
The IUPAC name of menthyl anthranilate is (5-methyl-2-propan-2-ylcyclohexyl) 2-aminobenzoate.
What is the InChI of menthyl anthranilate?
The InChI of menthyl anthranilate is InChI=1S/C17H25NO2/c1-11(2)13-9-8-12(3)10-16(13)20-17(19)14-6-4-5-7-15(14)18/h4-7,11-13,16H,8-10,18H2,1-3H3.
What is the InChIKey of menthyl anthranilate?
The InChIKey of menthyl anthranilate is SOXAGEOHPCXXIO-UHFFFAOYSA-N.
What is the canonical SMILES of menthyl anthranilate?
The canonical SMILES of menthyl anthranilate is CC1CCC(C(C1)OC(=O)C2=CC=CC=C2N)C(C)C.
What is the CAS number of menthyl anthranilate?
The CAS number of menthyl anthranilate is 134-09-8.
What is the ChEMBL ID of menthyl anthranilate?
The ChEMBL ID of menthyl anthranilate is CHEMBL1597075.
What is the XLogP3-AA value of menthyl anthranilate?
The XLogP3-AA value of menthyl anthranilate is 5.1.
What is the topological polar surface area of menthyl anthranilate?
The topological polar surface area of menthyl anthranilate is 52.3Ų.