What is the molecular formula of cis-Nerolidol?
The molecular formula of cis-Nerolidol is C15H26O.
What is the molecular weight of cis-Nerolidol?
The molecular weight of cis-Nerolidol is 222.37 g/mol.
What is the IUPAC name of cis-Nerolidol?
The IUPAC name of cis-Nerolidol is (6Z)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol.
Where can cis-Nerolidol be found in nature?
cis-Nerolidol is a natural product found in Rhododendron calostrotum, Rhododendron keiskei, and other organisms.
What is the InChIKey of cis-Nerolidol?
The InChIKey of cis-Nerolidol is FQTLCLSUCSAZDY-KAMYIIQDSA-N.
What is the canonical SMILES representation of cis-Nerolidol?
The canonical SMILES representation of cis-Nerolidol is CC(=CCCC(=CCCC(C)(C=C)O)C)C.
What is the CAS number of cis-Nerolidol?
The CAS number of cis-Nerolidol is 3790-78-1.
What is the UNII number of cis-Nerolidol?
The UNII number of cis-Nerolidol is 81K23DEF7B.
What is the XLogP3-AA value of cis-Nerolidol?
The XLogP3-AA value of cis-Nerolidol is 4.6.
How many hydrogen bond donors are present in cis-Nerolidol?
There is one hydrogen bond donor in cis-Nerolidol.